Details for 2-Hydroxyphenylacetic Acid
2-Hydroxyphenylacetic Acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
614-75-5 |
EC NO: |
210-393-2 |
Molecular Formula: |
C8H8O3 |
Molecular Weight: |
152.1399 |
Specification: |
|
InChI: |
InChI=1/C8H8O3/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4,9H,5H2,(H,10,11)/p-1 |
Synonyms: |
O-hydroxyphenylacetic acid;2-(2-hydroxyphenyl)acetic acid;hydroxy(phenyl)acetic acid;(2-hydroxyphenyl)acetate;o-hydroxylphenylacetic acid;2-Hydroxylphenylacetic acid;Intermediate of Azoxystrobin;Ortho hydroxyl phenyl acetic acid; |
Molecular Structure: |
|
if you are sourcing 2-Hydroxyphenylacetic Acid from Canada ,just feel free to inquire