Details for 4-Chlorobutyraldehyde Diethyl Acetal
4-Chlorobutyraldehyde Diethyl Acetal
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
6139-83-9 |
EC NO: |
|
Molecular Formula: |
C8H17ClO2 |
Molecular Weight: |
180.6724 |
Specification: |
|
InChI: |
InChI=1/C8H17ClO2/c1-3-10-8(11-4-2)6-5-7-9/h8H,3-7H2,1-2H3 |
Synonyms: |
4-chlorobutyraldehyde diethyl acetal;4-Chlorobutanal diethyl acetal;4-chloro butyraldehyde diethyl acetal;4-chloro butanal diethyl acetal;4-chloro-1,1-diethoxy butane;4-chloro-1,1-diethoxybutane; |
Molecular Structure: |
|
if you are sourcing 4-Chlorobutyraldehyde Diethyl Acetal from Canada ,just feel free to inquire