Details for Ethyl Thiooxamate

Ethyl Thiooxamate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
16982-21-1 |
EC NO: |
|
Molecular Formula: |
C4H7NO2S |
Molecular Weight: |
133.1689 |
Specification: |
|
InChI: |
InChI=1/C4H7NO2S/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) |
Synonyms: |
ETHYL AMINOTHIOXOACETATE;ETHYL THIOOXAMIDATE;ETHYL THIOXAMATE;aminothioxoacetic acid ethyl ester;thiooxamic acid ethyl ester;Acetic acid, 2-amino-2-thioxo-, ethyl ester;S-ethyl amino(oxo)ethanethioate;ethyl 2-amino-2-thioxoacetate; |
Molecular Structure: |
 |
if you are sourcing Ethyl Thiooxamate from Canada ,just feel free to inquire