Details for Chlorodifluoromethane
Chlorodifluoromethane
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
75-45-6 |
EC NO: |
200-871-9 |
Molecular Formula: |
CHClF2 |
Molecular Weight: |
86.4684 |
Specification: |
|
InChI: |
InChI=1/CHClF2/c2-1(3)4/h1H |
Synonyms: |
Chlorodifluoromethane;Chlorofluorocarbon 22;Fluorocarbon 22;Hydrochlorofluorocarbon 22;Methane, chlorodifluoro-;Propellant 22;Algeon 22;Algofrene 22;Algofrene type 6;Arcton 22;Arcton 4;BRN 1731036;CCRIS 858;CFC 22;Daiflon 22;Difluorochloromethane;Difluoromonochloromethane;Dymel 22;Electro-CF 22;Eskimon 22;F 22;F 22 (halocarbon);FC 22;FKW 22;Flugene 22;Fluorocarbon-22;Forane 22;Forane 22 B;Freon 22;Frigen;Frigen 22;Genetron 22;HCFC 22;HCFC-22;HFA-22;HSDB 143;Haltron 22;Isceon 22;Isotron 22;Khladon 22;Monochlorodifluoromethane;R 22 (refrigerant);R-22;Racon 22;Refrigerant R 22;Ucon 22;Chlorodifluoromethane [R22] [UN1018] [Nonflammable gas];R22;R22 [UN1018] [Nonflammable gas];UN1018;R22; |
Molecular Structure: |
|
if you are sourcing Chlorodifluoromethane from United-States ,just feel free to inquire