Details for EVA
EVA
111Category: |
Polymers/Synthetic resin and plastics |
|
CAS NO: |
24937-78-8 |
EC NO: |
|
Molecular Formula: |
C6H10O2 |
Molecular Weight: |
114.1424 |
Specification: |
|
InChI: |
InChI=1/C4H6O2.C2H4/c1-2-3-4(5)6;1-2/h2H,1,3H2,(H,5,6);1-2H2 |
Synonyms: |
Poly(ethylene-co-vinyl acetate);Acetic Acid Ethenyl Ester, Polymer with Ethene;Ethylene-vinyl acetate copolymer;Ethylene/vinyl acetate copolymer, 14% vinyl acetate;Ethylene-vinyl acetate copolymer resin;Ethylene-vinyl acetate latex;Ethylene-vinyl acetate molding resin;eva;Ethylene Vinyl Acetate;but-3-enoic acid-ethene (1:1);VAE;VAP; |
Molecular Structure: |
|
if you are sourcing EVA from China ,just feel free to inquire