Details for Lactic Acid
Lactic Acid
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
598-82-3;50-21-5 |
EC NO: |
200-018-0;209-954-4 |
Molecular Formula: |
C3H6O3 |
Molecular Weight: |
90.0705 |
Specification: |
|
InChI: |
InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/p-1/t2-/m1/s1 |
Synonyms: |
2-Hydroxypropanoic acid;2-Hydroxypropionic acid;Lactic acid;Lactic acid, dl-;Propanoic acid, 2-hydroxy-;(RS)-2-Hydroxypropionsaeure;1-Hydroxyethanecarboxylic acid;AI3-03130;Acidum lacticum;BRN 5238667;CCRIS 2951;Lactovagan;Tonsillosan;alpha-Hydroxypropionic acid;2-hydroxy-2-methylpropanoic acid;(2S)-2-hydroxypropanoate;(2R)-2-hydroxypropanoate; |
Molecular Structure: |
|
if you are sourcing Lactic Acid from South-Korea ,just feel free to inquire