Details for UV Absorber UV-9
![](/images/home/newal1.gif)
UV Absorber UV-9
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
131-57-7 |
EC NO: |
205-031-5 |
Molecular Formula: |
C14H12O3 |
Molecular Weight: |
228.2433 |
Specification: |
|
InChI: |
InChI=1/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H3 |
Synonyms: |
Oxybenzone;BP-3;UV-9;Benzophenone-3;Ultraviolet absorber UV-9;2-Hydroxy-4-Methoxy Benzophenone;2-Benzoyl-5-methoxyphenol;4-Methoxy-2-hydroxybenzophenone;2-Hydroxy-4-methoxy-benzotriazole;Ultraviolet absorbent UV-9;2-Hydroxy-4-methoxybenzophenone;UV absorber UV-9;(2-hydroxy-4-methoxyphenyl)(phenyl)methanone;UV-9;FENTAUNIV 9; |
Molecular Structure: |
![UV Absorber UV-9 131-57-7](https://images-a.chemnet.com/suppliers/chembase/170/1704.gif) |
if you are sourcing UV Absorber UV-9 from China ,just feel free to inquire