Details for ethyl acetate
ethyl acetate
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
141-78-6 |
| EC NO: |
205-500-4 |
| Molecular Formula: |
C4H8O2 |
| Molecular Weight: |
88.1051 |
| Specification: |
99.5%min |
| InChI: |
InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
| Packing: |
180kg/iron drum |
| Synonyms: |
Acetic acid ethyl ester;ethyl acetate B&J brand 4 L;ETHYLACETATE ULTRA RESI-ANAL.;ETHYL ACETATE CAPILLARY GRADE;Ethyl Acetate Specially Purified - SPECIFIED;Acetic Ether;RFE;acetic ester;EAC; |
| Molecular Structure: |
 |
if you are sourcing ethyl acetate from China ,just feel free to inquire
CN
China Suppliers > JIANYE > 
Search Product