Details for 1,2-Bis(2-chloroethoxy)ethane

1,2-Bis(2-chloroethoxy)ethane
| Category: |
Intermediates |
|
| CAS NO: |
112-26-5 |
| EC NO: |
203-952-7 |
| Molecular Formula: |
C6H12Cl2O2 |
| Molecular Weight: |
187.0643 |
| Specification: |
|
| InChI: |
InChI=1/C6H12Cl2O2/c1-6(9-4-2-7)10-5-3-8/h6H,2-5H2,1H3 |
| Synonyms: |
Triethylene glycol dichloride;Triglycol dichloride;
;1-chloro-2-[2-(2-chloroethoxy)ethoxy]ethane;1,1'-[ethane-1,1-diylbis(oxy)]bis(1-chloroethane);1,1-bis(2-chloroethoxy)ethane; |
| Molecular Structure: |
 |
if you are sourcing 1,2-Bis(2-chloroethoxy)ethane from China ,just feel free to inquire