Details for Allyl phenoxyacetate

Allyl phenoxyacetate
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
7493-74-5 |
EC NO: |
231-335-2 |
Molecular Formula: |
C11H12O3 |
Molecular Weight: |
192.2112 |
Specification: |
98%min |
InChI: |
InChI=1/C11H12O3/c1-2-8-13-11(12)9-14-10-6-4-3-5-7-10/h2-7H,1,8-9H2 |
Packing: |
200kg N.W. in Iron Drum |
Uses: |
Used in fragrances |
Synonyms: |
2-Propenyl phenoxyacetate;Acetate PA;prop-2-en-1-yl phenoxyacetate; |
Molecular Structure: |
 |
if you are sourcing Allyl phenoxyacetate from China ,just feel free to inquire