Details for accelerator M

accelerator M
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
149-30-4 |
EC NO: |
205-736-8 |
Molecular Formula: |
C7H5NS2 |
Molecular Weight: |
167.2513 |
Specification: |
|
InChI: |
InChI=1/C7H5NS2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4H,(H,8,9) |
Synonyms: |
2-Benzothiazolethiol;MBT;Sulfur Accelerator M;Benzothiazole-2-thiol;2-MBT;Z-MBT;1,3-benzothiazole-2(3H)-thione;M;Rubber Accelerator MBT;Rubber Pharmaceutical intermediate Refined(M);Rubber Accelerator M;2-Mercapto benzothiazole;ACCELERATOR MBT(M);ACCELERATOR MBT;ACCELERATOR M;Accelerator MBT; |
Molecular Structure: |
 |
if you are sourcing accelerator M from China ,just feel free to inquire