111Category: |
Intermediates/Pharmaceutical intermediates |
|
CAS NO: |
41340-36-7 |
EC NO: |
|
Molecular Formula: |
C12H15NO |
Molecular Weight: |
189.2536 |
Specification: |
Assay: ≥ 75% ; ≥ 97% |
InChI: |
InChI=1/C12H15NO/c1-2-12-7-4-3-5-11(12)13-9-10(12)6-8-14/h3-5,7,9,14H,2,6,8H2,1H3 |
Product description:
Structural Formula:
CAS No.: 41340-36-7
1.Description: Red to brown viscous substance; Assay: ≥75.0% Purity: ≥85.0%
2.Description: Red to brown viscous substance; Assay: ≥90.0% Purity: ≥95.0% |
|
Uses: |
Intermediate for Etodolac |
Synonyms: |
7-Ethyl Tryptophol;3-(2-Hydroxyethyl)-7-ethylindole;7-Ethyl-3-indoleethanol;7-Ethyl-1H-indole-3-ethanol;2-(7-ethyl-1H-indol-3-yl)ethanol;2-(3a-ethyl-3aH-indol-3-yl)ethanol;7-Ethyl tryptopholMethyl 3-oxovalerate; |
Molecular Structure: |
![7-Ethyl tryptophol 41340-36-7](https://images-a.chemnet.com/suppliers/chembase/174/174195_1.gif) |