Details for n-acethyl-3-chloro-l-serine methyl ester
![](/images/home/newal1.gif)
n-acethyl-3-chloro-l-serine methyl ester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
18635-38-6 |
EC NO: |
242-566-3 |
Molecular Formula: |
C6H10ClNO3 |
Molecular Weight: |
179.6015 |
Specification: |
|
InChI: |
InChI=1/C6H10ClNO3/c1-4(9)8-5(3-7)6(10)11-2/h5H,3H2,1-2H3,(H,8,9)/t5-/m0/s1 |
Synonyms: |
Methyl 2-acetylamino-3-chloropropionate;Methyl 2-(acetylamino)-3-chloropropanoate;N-Acethyl-3-chloro-L-serine Methyl ester;lutetium triacetate;methyl N-acetyl-3-chloro-L-alaninate; |
Molecular Structure: |
![n-acethyl-3-chloro-l-serine methyl ester 18635-38-6](https://images-a.chemnet.com/suppliers/chembase/204/204691_1.gif) |
if you are sourcing n-acethyl-3-chloro-l-serine methyl ester from China ,just feel free to inquire