Details for 2-Chloro-4-fluorobenzoic acid
2-Chloro-4-fluorobenzoic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
2252-51-9 |
| EC NO: |
218-845-0 |
| Molecular Formula: |
C7H3ClFO2 |
| Molecular Weight: |
173.5495 |
| Specification: |
|
| InChI: |
InChI=1/C7H4ClFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11)/p-1 |
| Synonyms: |
TIMTEC-BB SBB003795;RARECHEM AL BO 0405;Benzoic acid, 2-chloro-4-fluoro-;1-chloro-2-fluorobezene;2-Chloro-4-Fluorobenzoic;2-Chloro-4-fluorobenzoic acid 99%;2-Chloro-4-fluorobenzoicacid99%;2-[4-(trifluoromethyl)phenyl]propan-2-ol;2-chloro-4-fluorobenzoate;2-chloro-4-fiuorobenzoic acid; |
| Molecular Structure: |
 |
if you are sourcing 2-Chloro-4-fluorobenzoic acid from China ,just feel free to inquire
CN
China Suppliers > xieshichem > 
Search Product