Details for 3-Fluorophenylacetic acid
3-Fluorophenylacetic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
331-25-9 |
| EC NO: |
206-360-7 |
| Molecular Formula: |
C8H6FO2 |
| Molecular Weight: |
153.131 |
| Specification: |
|
| InChI: |
InChI=1/C8H7FO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| Synonyms: |
RARECHEM AL BO 0121;3-fluoro-benzeneaceticaci;3-Fluorophenlacetic acid;Acetic acid, (m-fluorophenyl)-;Benzeneacetic acid, 3-fluoro-;3-FLUOROPHENYLACETIC ACID;3-Fluorophenylacetic acid, 97+%;(3-fluorophenyl)acetate; |
| Molecular Structure: |
 |
if you are sourcing 3-Fluorophenylacetic acid from China ,just feel free to inquire
CN
China Suppliers > xieshichem > 
Search Product