Details for 4-Fluorophenylacetic acid
4-Fluorophenylacetic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
405-50-5 |
| EC NO: |
206-972-4 |
| Molecular Formula: |
C8H7FO2 |
| Molecular Weight: |
154.131 |
| Specification: |
|
| InChI: |
InChI=1/C8H7FO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| Synonyms: |
p-Fluorophenylacetic acid;Acetic acid, (p-fluorophenyl)-;(p-Fluorophenyl)acetic acid;(4-Fluorophenyl)acetic acid;Ba 2821;4-Fluorobenzeneacetic acid;(4-fluorophenyl)acetate;RARECHEM AL BO 0131;4 Fluorophenyl Acetic Acid;(4-Fluoro-phenyl)-acetic acid; |
| Molecular Structure: |
 |
if you are sourcing 4-Fluorophenylacetic acid from China ,just feel free to inquire
CN
China Suppliers > xieshichem > 
Search Product