Details for 2-bromobutyric acid

 
2-bromobutyric acid
 
      
        | Category: | 
        Catalyst and Auxiliary | 
        
        	 | 
      
      
        | CAS NO: | 
      80-58-0   | 
      
      
        | EC NO: | 
        
        201-294-5 | 
      
      
        | Molecular Formula: | 
        
        C4H6BrO2 | 
      
					
					  | Molecular Weight: | 
                      165.9938 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C4H7BrO2/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H,6,7)/p-1/t3-/m0/s1 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      2-Bromobutanoic acid;alpha-Bromobutyric acid;2-bromo-butanoicaci;alpha-Bromobytyric acid;Butanoic acid, 2-bromo-;Butyric acid, 2-bromo-;Butyric acid, alpha-bromo-;dl-2-Bromobutyric acid;dl-2-Bromobutyricacid;α-Bromobutyricacid;(2S)-2-bromobutanoic acid;(2R)-2-bromobutanoate;(2S)-2-bromobutanoate;Bromobutyric; | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  2-bromobutyric acid from  China ,just feel free to inquire