year
111Category: | Pharmaceuticals and Biochemicals |
|
||||||||||
CAS NO: | 632-22-4 | |||||||||||
EC NO: | 211-173-9 | |||||||||||
Molecular Formula: | C5H12N2O | |||||||||||
Molecular Weight: | 116.16 | |||||||||||
Specification: | ||||||||||||
InChI: | InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 | |||||||||||
Packing: | Packed in 180 kg iron drums | |||||||||||
Product description: Plasticizer or reaction solvent especially for the production of dyes Intermediate for pesticides, dyes and surfactants Biochemistry (protein denaturing in liquid, dissociation of hemoglobin)
|
||||||||||||
Synonyms: | Tetramethylurea; | |||||||||||
Molecular Structure: |
![]() |