Details for 3-methylbutanoic acid

3-methylbutanoic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
503-74-2 |
EC NO: |
207-975-3 |
Molecular Formula: |
C5H10O2 |
Molecular Weight: |
102.1243 |
Specification: |
|
InChI: |
InChI=1/C5H10O2/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H,6,7)/p-1 |
Synonyms: |
3-Methylbutyric acid;iso-Valeric acid;3-Methylbutanoic acid;Isopentanoic acid;Natural 3-methylbutyric acid;Natural Isovaleric Acid;3-methylbutanoate; |
Molecular Structure: |
 |
if you are sourcing 3-methylbutanoic acid from China ,just feel free to inquire