Details for ethyl phenyl ketone
![](/images/home/newal1.gif)
ethyl phenyl ketone
111Category: |
Organic chemicals and Derivatives/Aldehyde and ketone compounds |
|
CAS NO: |
93-55-0 |
EC NO: |
202-257-6 |
Molecular Formula: |
C9H10O |
Molecular Weight: |
134.1751 |
Specification: |
|
InChI: |
InChI=1/C9H10O/c1-2-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
Synonyms: |
1-Phenyl-1-propanone;Ethyl phenyl ketone;1-phenyl-1-propanon;1-phenyl-propan-1-one;1-phenylpropanone;1-phenylpropanone-1;1-Propanone,1-phenyl-;Ketone, ethyl phenyl;ketone,ethylphenyl;lithylphenyllwton;phenylpropone;Propionphenone;USAF ek-1235;usafek-1235;¦Áthylenphenylketon;AKOS BBS-00003274;FEMA 3469; |
Molecular Structure: |
![ethyl phenyl ketone 93-55-0](https://images-a.chemnet.com/suppliers/chembase/248/2487.gif) |
if you are sourcing ethyl phenyl ketone from China ,just feel free to inquire