Details for 3-Methylanthranilic acid
![](/images/home/newal1.gif)
3-Methylanthranilic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
4389-45-1 |
EC NO: |
224-505-2 |
Molecular Formula: |
C8H9NO2 |
Molecular Weight: |
151.1626 |
Specification: |
|
InChI: |
InChI=1/C8H9NO2/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
Synonyms: |
3-Methylanthranilic acid;3-Methyl-2-Amino Benzoic Acid;2-Amino-3-Methybenzoic Acid;2-Aminobenzoic-3-methyl acid; |
Molecular Structure: |
![3-Methylanthranilic acid 4389-45-1](https://images-a.chemnet.com/suppliers/chembase/327/327.gif) |
if you are sourcing 3-Methylanthranilic acid from China ,just feel free to inquire