Details for Potassium Monoethyl malonate

Potassium Monoethyl malonate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
6148-64-7 |
EC NO: |
228-156-7 |
Molecular Formula: |
C5H7KO4 |
Molecular Weight: |
170.205 |
Specification: |
|
InChI: |
InChI=1/C5H8O4.K/c1-2-9-5(8)3-4(6)7;/h2-3H2,1H3,(H,6,7);/q;+1/p-1 |
Synonyms: |
:Monoethyl malonate potassium salt;Potassium monoethyl malonate;potassium 3-ethoxy-3-oxopropanoate;Ethylpotassium malonate;ETHYL MALONATE MONOPOTASSIUM SALT; |
Molecular Structure: |
 |
if you are sourcing Potassium Monoethyl malonate from China ,just feel free to inquire