Details for Ethyl furoate
![](/images/home/newal1.gif)
Ethyl furoate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
614-99-3 |
EC NO: |
210-404-0;215-631-9 |
Molecular Formula: |
C7H8O3 |
Molecular Weight: |
140.13 |
Specification: |
|
InChI: |
InChI=1/C7H8O3/c1-2-9-7(8)6-4-3-5-10-6/h3-5H,2H2,1H3 |
Synonyms: |
Ethyl 2-furoate;2-Furoic acid ethyl ester;Ethyl furan-2-carboxylate;2-Furoic acid ethyl ester;2-furoicacid ethyl ester;Ethyl furoate;Furoic acid, ethyl ester;UNII-31OM7UT24E;Furancarboxylic acid, ethyl ester;ethyl furan-2-carboxylate; |
Molecular Structure: |
![Ethyl furoate 614-99-3](https://images-a.chemnet.com/suppliers/chembase/147/1472.gif) |
if you are sourcing Ethyl furoate from China ,just feel free to inquire