Details for Methyl furoate

Methyl furoate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
611-13-2 |
EC NO: |
210-254-6 |
Molecular Formula: |
C6H6O3 |
Molecular Weight: |
126.11 |
Specification: |
|
InChI: |
InChI=1/C6H6O3/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
Synonyms: |
Furan-2-carboxylic acid methyl ester;2-Furoic acid methyl ester;Methyl furan-2-carboxylate;Methyl pyromucate;RARECHEM AL BF 0007;PYROMUCIC ACID METHYL ESTER;Methyl furoate; |
Molecular Structure: |
 |
if you are sourcing Methyl furoate from China ,just feel free to inquire