| Category: | Intermediates/Dyestuff intermediates |  | 
      
        | CAS NO: | 97-36-9 | 
      
        | EC NO: | 202-576-0 | 
      
        | Molecular Formula: | C12H15NO2 | 
					
					  | Molecular Weight: | 205.253 | 
                    
                      | Specification: | Assay , % ≥ 99.0 | 
                    
                      | InChI: | InChI=1/C12H15NO2/c1-8-4-5-11(9(2)6-8)13-12(15)7-10(3)14/h4-6H,7H2,1-3H3,(H,13,15) | 
                    
                      | Packing: | container(300kg/bag)woven bag lined with plastic bag, paper bag 25kg. | 
                    
                      | Product description: 
 
 
                                  |  
                                       
                                      Product: ACETOACET- M-XYLIDIDE |   
                                  | Category: | DYESTUFF & PIGMENT INTERMEDIATES 
 |   
                                  | Cas No.: | 97-36-9 |   
                                  | Standard: | Q/320601 NS15-2000 |   
                                  | Structure Formula: |  |   
                                  | Description: | 
                                
                                
                                                      | Product name:ACETOACET M-XYLIDIDE 
                                                        AAMX |  
                                | Molecular formula:C12H15NO2 | Molecular weight:205.26 |  
                                                      | Appearance: white to 
                                                        light yellow or slight 
                                                        pink crystal powder |  |  Quality index: 
                                
                                
                                | Item | Index |  
                                  | Identification test | Meet the standard |  
                                | Assay ,  % ≥ | 99.0 |  
                                | Initial melting point 癈 ≥ | 88.0 |  
                                | Volatile matter, % ≤ | 0.5 |  
                                | Turbidity in alkali | clear transparent or 
                                                        mainly clear transparent |  Uses: intermediate of organic pigment Packing: container(300kg/bag)woven bag lined with plastic bag, paper bag 25kg.  |  | 
                    
                      | Uses: | intermediate of organic pigment | 
                    
                    
                      | Synonyms: | 2',4'-dimethylacetoacetanilide;acetoacet-m-xylidide;n-(2,4-dimethylphenyl)-3-oxobutyramide;2',4'-Acetoacetoxylidide;AAMX;N-(2,4-dimethylphenyl)-2-oxobutanamide;N-(2,4-dimethylphenyl)-3-oxobutanamide;ACETOACET M XYLIDIDE; | 
					
                      | Molecular Structure: |  |