Details for Natural Vanillin
Natural Vanillin
| 111Category: |
Intermediates |
|
| CAS NO: |
121-33-5 |
| EC NO: |
204-465-2 |
| Molecular Formula: |
C8H8O3 |
| Molecular Weight: |
152.1473 |
| Specification: |
99.5% MIN |
| InChI: |
InChI:1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 |
| Packing: |
25kg/bag |
| Uses: |
flavor and fragrance |
| Synonyms: |
4-Hydroxy-3-methoxybenzaldehyde;Vanilline;Vanilin;Vanillin natural;2-Methoxy-4-formylphenol;3-Methoxy-4-hydroxybenzaldehyde;4-Formyl-2-methoxyphenol;4-Hydroxy-3-methoxy-benzaldehyde;Vanillaldehyde; |
| Molecular Structure: |
 |
if you are sourcing Natural Vanillin from China ,just feel free to inquire
CN
China Suppliers > taisongchem > 
Search Product