Details for 4-fluorobenzyl chloride
4-fluorobenzyl chloride
| 111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
| CAS NO: |
352-11-4 |
| EC NO: |
206-516-4 |
| Molecular Formula: |
C7H6FCl |
| Molecular Weight: |
144.5760 |
| Specification: |
|
| InChI: |
InChI:1S/C7H6ClF/c8-5-6-1-3-7(9)4-2-6/h1-4H,5H2 |
| Synonyms: |
alpha-Chloro-4-fluorotoluene;1-(chloromethyl)-4-fluorobenzene;1-(chloromethyl)-4-fluoro benzene;alpha-Chloro-p-fluorotoluene;ethyl 3,3,3-trifluoropropanoate;1-(chloromethyl)-4-fluoro-benzen;P-Fluorobenzyl Chloride;Para-Fluorobenzyl chloride; |
| Molecular Structure: |
 |
if you are sourcing 4-fluorobenzyl chloride from China ,just feel free to inquire
CN
China Suppliers > Guanjin Chemica > 
Search Product