Details for paracymene
paracymene
| 111Category: |
Intermediates |
|
| CAS NO: |
99-87-6 |
| EC NO: |
202-796-7 |
| Molecular Formula: |
C10H14 |
| Molecular Weight: |
134.22 |
| Specification: |
|
| InChI: |
InChI=1/C10H14/c1-8(2)10-6-4-9(3)5-7-10/h4-8H,1-3H3 |
Product description:
| Application: |
para-cymene is an aromatic hydrocarbon of intermediate purity which is suitable for many applications. Its specific use is an intermediate in the synthesis of musk aroma chemicals. |
| Specification: |
| Physical Form |
liquid |
| Color, APHA |
10 max |
| Content of paracymene by GC |
97% min |
| Specific gravity (D420) |
0.854-0.857 |
| Refractive Index @ 20°C |
1.4880-1.4920 |
|
| Packing: |
in galvanized iron drums of 175kgs net each or in iso tank containers |
| Transport Information: |
Proper shipping name: Cymenes
IMO: 3.3, UN Number: 2046,
Packaging group: III |
|
| Synonyms: |
Dolcymene;4-Isopropyltoluene;Para-Cymene; |
| Molecular Structure: |
 |
if you are sourcing paracymene from China ,just feel free to inquire
CN
China Suppliers > sunyuanchem > 
Search Product