Details for 1,4-Cyclohexan dimethanol divinyl ether
1,4-Cyclohexan dimethanol divinyl ether
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
17351-75-6 |
EC NO: |
|
Molecular Formula: |
C9H16N2 |
Molecular Weight: |
152.2367 |
Specification: |
|
InChI: |
InChI=1/C9H16N2/c1-6(2)8-5-9(7(3)4)11-10-8/h5-7H,1-4H3,(H,10,11) |
Synonyms: |
1,4-Cyclohexanedimethanol divinyl ether,mixture of isomers;1,4-bis(prop-1-en-1-yloxy)cyclohexane;3,5-bis(1-methylethyl)-1H-pyrazole;1,4-Cyclohexan dimethanol divinyl ether; |
Molecular Structure: |
|
if you are sourcing 1,4-Cyclohexan dimethanol divinyl ether from China ,just feel free to inquire