Details for Poly(methyl vinyl ether/maleic anhydride)copolymer

Poly(methyl vinyl ether/maleic anhydride)copolymer
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
9011-16-9 |
EC NO: |
|
Molecular Formula: |
C7H8O4 |
Molecular Weight: |
156.136 |
Specification: |
|
InChI: |
InChI=1/C4H2O3.C3H6O/c5-3-1-2-4(6)7-3;1-3-4-2/h1-2H;3H,1H2,2H3 |
Synonyms: |
Poly(methyl vinyl ether-alt-maleic anhydride);PVM/MA;Copolymer of Methyl Vinyl Ether/Maleic Anhydride;PVM/MA Copolymer;Poly(methyl vinyl ether/maleic anhydride) copolymer; |
Molecular Structure: |
 |
if you are sourcing Poly(methyl vinyl ether/maleic anhydride)copolymer from China ,just feel free to inquire