Details for Methyl Ethyl Ketoxime
Methyl Ethyl Ketoxime
| 111Category: |
Organic chemicals and Derivatives/Aldehyde and ketone compounds |
|
| CAS NO: |
96-29-7 |
| EC NO: |
202-496-6 |
| Molecular Formula: |
C4H9NO |
| Molecular Weight: |
87.1204 |
| Specification: |
|
| InChI: |
InChI=1/C4H9NO/c1-3-4(2)5-6/h6H,3H2,1-2H3/b5-4- |
| Synonyms: |
2-Butanone oxime;2-butoxime;aron m 1;butanone oxime;ethyl methyl ketoxime;Methyl ethyl ketoxime;(2E)-butan-2-one oxime;(2Z)-butan-2-one oxime;MEKO; |
| Molecular Structure: |
 |
if you are sourcing Methyl Ethyl Ketoxime from China ,just feel free to inquire
CN
China Suppliers > chinameko > 
Search Product