Details for Dimethyl Glutarate
Dimethyl Glutarate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
1119-40-0 |
EC NO: |
214-277-2 |
Molecular Formula: |
C10H11NO |
Molecular Weight: |
161.2004 |
Specification: |
|
InChI: |
InChI=1/C10H11NO/c1-7-8-5-6-11-9(8)3-4-10(7)12-2/h3-6,11H,1-2H3 |
Synonyms: |
dbe-5 dibasic ester;Glutaric acid dimethyl ester;Pentanedioic acid dimethyl ester;DIMETHYLE GLUTARATE;DBE-2;dimethyl pentanedioate;dimethyl glutamate;5-methoxy-4-methyl-1H-indole; |
Molecular Structure: |
|
if you are sourcing Dimethyl Glutarate from China ,just feel free to inquire