Details for Diethylene glycol monobuthyl ether acetate

Diethylene glycol monobuthyl ether acetate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
124-17-4 |
EC NO: |
204-685-9 |
Molecular Formula: |
C10H22O5 |
Molecular Weight: |
222.2787 |
Specification: |
|
InChI: |
InChI=1/C6H12O2.C4H10O3/c1-3-4-5-8-6(2)7;5-1-3-7-4-2-6/h3-5H2,1-2H3;5-6H,1-4H2 |
Synonyms: |
2-(2-butoxyethoxy)-Ethanol acetate;2-(2-Butoxyethoxy)ethyl acetate;2-(2-n-Butoxyethoxy)ethyl Acetate;Diethylene Glycol Butyl Ether Acetate;Diethylene glycol monobutyl ether acetate;Diethylene Glycol Mono-n-butyl Ether Acetate;Diglycol Monobutyl Ether Acetate;Butyl Carbitol Acetate;n-Butyl Carbitol Acetate;Diethylene glycol monobutyl ether acetate(DBAC);butyl acetate - 2,2'-oxydiethanol (1:1);Diethylene glycol monobuthyl ether acetate; |
Molecular Structure: |
 |
if you are sourcing Diethylene glycol monobuthyl ether acetate from China ,just feel free to inquire