Details for Propylene glycol monoethyl ether

Propylene glycol monoethyl ether
Category: |
Organic chemicals and Derivatives/Alcohol and aether compounds |
|
CAS NO: |
1569-02-4 |
EC NO: |
216-374-5 |
Molecular Formula: |
C5H12O2 |
Molecular Weight: |
104.1476 |
Specification: |
|
InChI: |
InChI=1/C5H12O2/c1-3-7-4-5(2)6/h5-6H,3-4H2,1-2H3/t5-/m1/s1 |
Synonyms: |
1-Ethoxypropan-2-ol;2-propanol, 1-ethoxy-;(2S)-1-ethoxypropan-2-ol;(2R)-1-ethoxypropan-2-ol;Propylene glycol monoethyl ether;Ethoxy Propanol; |
Molecular Structure: |
 |
if you are sourcing Propylene glycol monoethyl ether from China ,just feel free to inquire