Details for HC Yellow 5

HC Yellow 5
| Category: |
Intermediates/Dyestuff intermediates |
|
| CAS NO: |
56932-44-6 |
| EC NO: |
260-450-0 |
| Molecular Formula: |
C8H11N3O3 |
| Molecular Weight: |
197.1912 |
| Specification: |
|
| InChI: |
InChI=1/C8H11N3O3/c9-7-5-6(11(13)14)1-2-8(7)10-3-4-12/h1-2,5,10,12H,3-4,9H2 |
| Synonyms: |
2(2-Amino-4-nitroanilino)-ethanol;2-Amino-4-Nitro-N-(2-Ethoxyl)Phenylamine;2-Amino-4-Nitro-N-Hydroxyethyl aniline;2-amino-4-nitro-n-(2-hydroxyethyl)aniline;2-[(2-amino-4-nitrophenyl)amino]ethanol;1-N-HYDROXYETHYL-2-AMINO-4-NITROANILINE;HC YELLOW 5;N-HYDROXYETHYL-2-AMINO-4-NITROANILINE;HC Yellow No.5;N1-(2-Hydroxyethyl)-4-nitro-o-phenylenediamine; |
| Molecular Structure: |
 |
if you are sourcing HC Yellow 5 from China ,just feel free to inquire