Details for Lactic acid

Lactic acid
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
50-21-5 |
| EC NO: |
200-018-0;209-954-4 |
| Molecular Formula: |
C3H6O3 |
| Molecular Weight: |
90.0705 |
| Specification: |
|
| InChI: |
InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/p-1/t2-/m1/s1 |
| Synonyms: |
2-Hydroxypropanoic acid;2-Hydroxypropionic acid;Lactic acid;Lactic acid, dl-;Propanoic acid, 2-hydroxy-;(RS)-2-Hydroxypropionsaeure;1-Hydroxyethanecarboxylic acid;AI3-03130;Acidum lacticum;BRN 5238667;CCRIS 2951;Lactovagan;Tonsillosan;alpha-Hydroxypropionic acid;2-hydroxy-2-methylpropanoic acid;(2S)-2-hydroxypropanoate;(2R)-2-hydroxypropanoate; |
| Molecular Structure: |
 |
if you are sourcing Lactic acid from China ,just feel free to inquire