| Category: |
Intermediates/Pharmaceutical intermediates |
|
| CAS NO: |
328-38-1 |
| EC NO: |
206-327-7 |
| Molecular Formula: |
C6H13NO2 |
| Molecular Weight: |
131.1729 |
| Specification: |
|
| InChI: |
InChI=1/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1 |
Product description:
ProName: D-Leucine CasNo: 328-38-1 Application: organic intermediate PackAge: bottleļ¼drum or according to the requir... Purity: 98% Storage: Store in a cool, dry, well-ventilated ...Transportation: by courier,sea and air LimitNum: 0 |
| Synonyms: |
2S)-alpha-leucine;(S)-(+)-Leucine;(S)-2-Amino-4-methylvaleric acid;(S)-Leucine;2-Amino-4-methylpentanoic acid (L);2-Amino-4-methylpentanoic acid, (S)-;2-Amino-4-methylvaleric acid (L);4-Methyl-norvaline;D-Leucine;D-Leu;H-D-Leucine;H-D-Leu-OH; |
| Molecular Structure: |
 |