| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
6306-52-1 |
| EC NO: |
228-620-9 |
| Molecular Formula: |
C6H14NO2 |
| Molecular Weight: |
132.1803 |
| Specification: |
|
| InChI: |
InChI=1/C6H13NO2/c1-4(2)5(7)6(8)9-3/h4-5H,7H2,1-3H3/p+1/t5-/m1/s1 |
Product description:
Keywords
6306-52-1 L-Valine Methyl Ester Hydrochloride
ProName: L-Valine Methyl Ester Hydrochloride CasNo: 6306-52-1 Appearance: white powder Application: Valsartan Purity: 99% Storage: Keep away of light,cool place Transportation: Sea/air/courier LimitNum: 0 |
| Synonyms: |
H-Val-OMe.HCl;L-Valine methyl ester HCL;Val-ome.hcl;Methyl valinate hydrochloride;L-Valine Methyl Estet HCL;methyl L-valinate;(2S)-1-methoxy-3-methyl-1-oxobutan-2-aminium;(2R)-1-methoxy-3-methyl-1-oxobutan-2-aminium;Valine methyl ester hydrochloride, L-;H-Val-OMe·HCl;H-Val-OMe•HCl;(S)-Methyl 2-amino-3-methylbutanoate hydrochloride; |
| Molecular Structure: |
 |