111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
95-14-7 |
EC NO: |
202-394-1 |
Molecular Formula: |
C6H5N3 |
Molecular Weight: |
119.12 |
Specification: |
Purity: 99.8% min |
InChI: |
InChI=1/C6H5N3/c1-2-4-6-5(3-1)7-9-8-6/h1-4H,(H,7,8,9) |
Packing: |
in woven plastic bags,mutiple bags or fiber drums with plastic bags in. |
Product description:
| CAS NO. | 95-14-7 | Molecular weight: | 119 | | Chemical formulation: | C6H5N3 | | | | Shape & properties: | white needle-shape crystalloids, it can be processed to be big flake, column, fine granular, powder. | | Properties: | It's bitter, odorless, boiling point is 204℃(15mmHG),soluble in alcohol, benzene, toluene, chloroform and dimethylformamide, and slightly soluble in water. | | Uses: | It's mainly used as rust-preventer,antifreezing liquid,antioxidant additive(including lubricating oil,hydraulic oil,brake oil,transformer's oil),emugent,water stabilizer,the additive for high molecular materials'(polyester and polyesteramide)capacity of ultraviolet resistance and anstatic electricity,photographic antifogging agent,copper mine flotation,metal's slow corrosion etc. | | Safety properties: | It's not inflammable or explosive or corrosive,low poison and the LD50 for small mouse is 965mg/kg. | | Packing: | in woven plastic bags,mutiple bags or fiber drums with plastic bags in. | | Net weight: | 10kg, 20kg, 25kg, 200kg | | Structural formula: | | Specifications: | Guide name | Guide | Purity | ≥99.8% | Chroma | ≤NO.40 | Moisture | ≤0.04% | Melting point | ≥97癈 | Ash content: | ≤0.03% | PH value | 5-6 |
| |
|
Uses: |
It's mainly used as rust-preventer,antifreezing liquid,antioxidant additive(including lubricating oil,hydraulic oil,brake oil,transformer's oil),emugent,water stabilizer,the additive for high molecular materials'(polyester and polyesteramide)capacity of u |
Synonyms: |
1,2,3-benzotriazole;Benzotraizole;T406 petroleum additive;1,2,3-Benzotrialole;1,2,3-benzo triazole;BTA;benzotriazole;1,2,3-benzotriazole (BTA);benzotriazole (BTA);BTA (1H-Benzotriazole); |
Molecular Structure: |
|