Details for 1-Pyrenylboronic acid
![](/images/home/newal1.gif)
1-Pyrenylboronic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
164461-18-1 |
EC NO: |
|
Molecular Formula: |
C16H11BO2 |
Molecular Weight: |
246.0683 |
Specification: |
|
InChI: |
InChI=1/C16H11BO2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,18-19H |
Synonyms: |
PYRENE-1-BORONIC ACID;1-PYRENEBORONIC ACID;1-Pyreneboronic Acid (contains varying amounts of Anhydride);1-Pyreneboronic acid, 1-Pyrenylboronic acid;pyren-1-ylboronic acid; |
Molecular Structure: |
![1-Pyrenylboronic acid 164461-18-1](https://images-a.chemnet.com/suppliers/chembase/cas/cas164461-18-1.gif) |
if you are sourcing 1-Pyrenylboronic acid from China ,just feel free to inquire