Details for 2-Fluoro-5-methoxyphenylboronic acid
2-Fluoro-5-methoxyphenylboronic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
406482-19-7 |
| EC NO: |
|
| Molecular Formula: |
C7H8BFO3 |
| Molecular Weight: |
169.946 |
| Specification: |
|
| InChI: |
InChI=1/C7H8BFO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,10-11H,1H3 |
| Synonyms: |
(2-Fluoro-5-methoxyphenyl)boronic acid;boronic acid, B-(2-fluoro-5-methoxyphenyl)-;2-Fluoro-5-methoxyphenyl boronic acid;2-Fluoro-5-methoxyphenylboronic acid; |
| Molecular Structure: |
 |
if you are sourcing 2-Fluoro-5-methoxyphenylboronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product