Details for 2-Thiopheneboronic acid

2-Thiopheneboronic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
6165-68-0 |
EC NO: |
|
Molecular Formula: |
C4H5BO2S |
Molecular Weight: |
127.9573 |
Specification: |
|
InChI: |
InChI=1/C4H5BO2S/c6-5(7)4-2-1-3-8-4/h1-3,6-7H |
Synonyms: |
2-Thiophene Boric Acid;2-Thiopheneboronic acid;2-Thienylboronic acid;thiophen-3-ylboronic acid;thiophen-2-ylboronic acid;2-thiophene boronic acid; |
Molecular Structure: |
 |
if you are sourcing 2-Thiopheneboronic acid from China ,just feel free to inquire