Details for 3-(Methylthio)phenylboronic acid
3-(Methylthio)phenylboronic acid
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
128312-11-8 |
| EC NO: |
|
| Molecular Formula: |
C7H9BO3S |
| Molecular Weight: |
184.0206 |
| Specification: |
|
| InChI: |
InChI=1/C7H9BO3S/c9-8(10)5-11-6-2-1-3-7(12)4-6/h1-2,4,9-10H,3,5H2 |
| Synonyms: |
3-Thioanisoleboronic acid;3-Thioanisoleboronic acid;3-(methylsulfanyl)phenylboronic acid;3-(Methylthio)benzeneboronic acid;{[(3-thioxocyclohexa-1,5-dien-1-yl)oxy]methyl}boronic acid;3-Methylthiophenylboronic acid;[3-(Methylthio)-Benzene]-Boronic Acid; |
| Molecular Structure: |
 |
if you are sourcing 3-(Methylthio)phenylboronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product