Details for 3-Aminophenylboronic acid monohydrate
3-Aminophenylboronic acid monohydrate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
206658-89-1 |
EC NO: |
250-189-0 |
Molecular Formula: |
C6H10BNO3 |
Molecular Weight: |
154.9595 |
Specification: |
|
InChI: |
InChI=1/C6H8BNO2.H2O/c8-6-3-1-2-5(4-6)7(9)10;/h1-4,9-10H,8H2;1H2 |
Synonyms: |
3-Aminobenzeneboronic acid monohydrate;(3-aminophenyl)boronic acid;(3-aminophenyl)boronic acid hydrate;M-AMINOPHENYLBORONIC ACID monohydrate; |
Molecular Structure: |
|
if you are sourcing 3-Aminophenylboronic acid monohydrate from China ,just feel free to inquire