Details for 3-Biphenyl boronic acid
3-Biphenyl boronic acid
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
5122-95-2 |
| EC NO: |
|
| Molecular Formula: |
C12H11BO2 |
| Molecular Weight: |
198.0255 |
| Specification: |
|
| InChI: |
InChI=1/C12H11BO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,14-15H |
| Synonyms: |
3-Biphenylboronic acid;(1,1-Biphenyl-3-yl)boronic acid;[1,1-Biphenyl]-3-ylboronic acid;[1,1'-Biphenyl]-3-ylboronic acid;biphenyl-3-ylboronic acid;3-Phenylbenzeneboronic acid;3-Biphenyl boronic acid; |
| Molecular Structure: |
 |
if you are sourcing 3-Biphenyl boronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product