Details for 3-Bromo-5-chlorophenyl boronic acid
3-Bromo-5-chlorophenyl boronic acid
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
1186403-17-7 |
| EC NO: |
|
| Molecular Formula: |
C6H5BBrClO2 |
| Molecular Weight: |
235.2715 |
| Specification: |
|
| InChI: |
InChI=1S/C6H5BBrClO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
| Synonyms: |
b-(3-bromo-5-chlorophenyl)boronic acid;3-Bromo-5-chlorophenyl boronic acid;3-Bromo-5-chlorophenylboronic acid: |
| Molecular Structure: |
 |
if you are sourcing 3-Bromo-5-chlorophenyl boronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product