Details for 3-Methoxy-4-methylphenylboronic acid
3-Methoxy-4-methylphenylboronic acid
| 111Category: |
Adhesives and Sealants |
|
| CAS NO: |
917757-15-4 |
| EC NO: |
|
| Molecular Formula: |
C8H11BO3 |
| Molecular Weight: |
165.9821 |
| Specification: |
|
| InChI: |
InChI=1/C8H11BO3/c1-6-3-4-7(9(10)11)5-8(6)12-2/h3-5,10-11H,1-2H3 |
| Synonyms: |
(3-Methoxy-4-methylphenyl)boronic acid;3-Methoxy-4-methylphenylboronic acid;3-Methoxy-p-tolylboronic acid;B-(3-Methoxy-4-methylphenyl)boronic acid;boronic acid, B-(3-methoxy-4-methylphenyl)-;QBQR D1 CO1; |
| Molecular Structure: |
 |
if you are sourcing 3-Methoxy-4-methylphenylboronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product