Details for 3-Tolylboronic acid
3-Tolylboronic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
17933-03-8 |
EC NO: |
|
Molecular Formula: |
C7H9BO2 |
Molecular Weight: |
135.9562 |
Specification: |
|
InChI: |
InChI=1/C7H9BO2/c1-6-3-2-4-7(5-6)8(9)10/h2-5,9-10H,1H3 |
Synonyms: |
m-Tolylboronic acid;3-methylbenzeneboronic acid;(3-methylphenyl)boronic acid;3-Methylphenylboric acid;3-METHYLPHENYLBORONIC ACID;3-Methyl Phenyl Boronic Acid;3-Methylphenyl boronic acid: |
Molecular Structure: |
|
if you are sourcing 3-Tolylboronic acid from China ,just feel free to inquire