Details for 3-Vinylphenylboronic acid
3-Vinylphenylboronic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
15016-43-0 |
EC NO: |
|
Molecular Formula: |
C8H9BO2 |
Molecular Weight: |
147.9669 |
Specification: |
|
InChI: |
InChI=1/C8H9BO2/c1-2-7-4-3-5-8(6-7)9(10)11/h2-6,10-11H,1H2 |
Synonyms: |
3-VINYLBENZENEBORONIC ACID;AKOS BRN-0142;RARECHEM AH PB 0211;styrene-3-boronic acid;3-Vinylphenylbronicacid;(3-ethenylphenyl)boronic acid; |
Molecular Structure: |
|
if you are sourcing 3-Vinylphenylboronic acid from China ,just feel free to inquire