Details for 4-Methoxyphenylboronic acid
4-Methoxyphenylboronic acid
| 111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
5720-07-0 |
| EC NO: |
|
| Molecular Formula: |
C7H9BO |
| Molecular Weight: |
119.9568 |
| Specification: |
|
| InChI: |
InChI=1/C7H9BO/c1-9-7-4-2-6(8)3-5-7/h2-5H,8H2,1H3 |
| Synonyms: |
(4-Methoxyphenyl)boronic acid;Boronic acid, B-(4-methoxyphenyl)-;4-Methoxybenzeneboronic Acid;(4-methoxyphenyl)borane; |
| Molecular Structure: |
 |
if you are sourcing 4-Methoxyphenylboronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product